ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
87-64-9 2-Chloro-6-methylphenol |
|
Ürün Adı | 2-Chloro-6-methylphenol |
ingilizce adı | 2-Chloro-6-methylphenol;2-Chloro-6-methylphenol,98%;6-Chloro-o-cresol (OH=1);6-Chloro-o-cresol |
Moleküler Formülü | C7H7ClO |
Molekül Ağırlığı | 142.5829 |
InChI | InChI=1/C7H7ClO/c1-5-3-2-4-6(8)7(5)9/h2-4,9H,1H3 |
CAS kayıt numarası | 87-64-9 |
EINECS | 201-760-8 |
Moleküler Yapısı | |
Yoğunluk | 1.228g/cm3 |
Kaynama noktası | 200.4°C at 760 mmHg |
Kırılma indisi | 1.565 |
Alevlenme noktası | 75°C |
Buhar basıncı | 0.229mmHg at 25°C |
Risk Kodları | R21/22##Harmful in contact with skin and if swallowed.||R36/38##Irritating to eyes and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S28##After contact with skin, wash immediately with plenty of ...||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |