ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
86-26-0 2-Methoxybiphenyl |
|
Ürün Adı | 2-Methoxybiphenyl |
ingilizce adı | 2-Methoxybiphenyl;2-Phenylanisole;biphenyl-2-yl methyl ether;o-Methoxybiphenyl |
Moleküler Formülü | C13H12O |
Molekül Ağırlığı | 184.2338 |
InChI | InChI=1/C13H12O/c1-14-13-10-6-5-9-12(13)11-7-3-2-4-8-11/h2-10H,1H3 |
CAS kayıt numarası | 86-26-0 |
EINECS | 201-659-9 |
Moleküler Yapısı | |
Yoğunluk | 1.03g/cm3 |
Ergime noktası | 30-33℃ |
Kaynama noktası | 274°C at 760 mmHg |
Kırılma indisi | 1.556 |
Alevlenme noktası | 101.3°C |
Buhar basıncı | 0.00928mmHg at 25°C |
Tehlike Sembolleri | Xn##Harmful:; |
Risk Kodları | R33##Danger of cummulative effects.:; |
Güvenlik Açıklaması | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |