ChemIndex - Ücretsiz bir kimyasal CAS veritabanıChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
5,6-Benzoquinoline |
|
Ürün Adı | 5,6-Benzoquinoline |
ingilizce adı | 5,6-Benzoquinoline;beta-Naphthoquinoline;1-Azaphenanthrene;Benzo[f]quinoline;Benzoquinoline;benzo(f)quinoline |
Moleküler Formülü | C13H9N |
Molekül Ağırlığı | 179.2173 |
InChI | InChI=1/C13H9N/c1-2-5-11-10(4-1)7-8-13-12(11)6-3-9-14-13/h1-9H |
CAS kayıt numarası | 85-02-9 |
EINECS | 201-582-0 |
Moleküler Yapısı | |
Yoğunluk | 1.187g/cm3 |
Ergime noktası | 89-91℃ |
Kaynama noktası | 350.4°C at 760 mmHg |
Kırılma indisi | 1.726 |
Alevlenme noktası | 155.9°C |
Buhar basıncı | 8.89E-05mmHg at 25°C |
Tehlike Sembolleri | Xn##Harmful:; |
Risk Kodları | R36/37/38##Irritating to eyes, respiratory system and skin.||R40##Possible risks of irreversible effects.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |