ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
84434-04-8 2-aminoetanol, 1H-benzotriazol ile bileşik |
|
Ürün Adı | 2-aminoetanol, 1H-benzotriazol ile bileşik |
Eş anlamlı | 2-Aminoetanol, 1H-benzotriazol ile bileşik; 2-aminoetanol - 1H-benzotriazol (1:1); |
ingilizce adı | 2-aminoethanol, compound with 1H-benzotriazole;2-Aminoethanol, compound with 1H-benzotriazole;2-aminoethanol - 1H-benzotriazole (1:1) |
Moleküler Formülü | C8H12N4O |
Molekül Ağırlığı | 180.2071 |
InChI | InChI=1/C6H5N3.C2H7NO/c1-2-4-6-5(3-1)7-9-8-6;3-1-2-4/h1-4H,(H,7,8,9);4H,1-3H2 |
CAS kayıt numarası | 84434-04-8 |
EINECS | 282-802-2 |
Moleküler Yapısı | |
Kaynama noktası | 496.3°C at 760 mmHg |
Alevlenme noktası | 254°C |
Buhar basıncı | 1.14E-10mmHg at 25°C |
MSDS |