ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
83-24-9 2,5-Dimethyl-1-phenylpyrrole |
|
Ürün Adı | 2,5-Dimethyl-1-phenylpyrrole |
ingilizce adı | 2,5-Dimethyl-1-phenylpyrrole;1H-Pyrrole, 2,5-dimethyl-1-phenyl-;NSC 163170;2,5-Dimethyl-1-phenyl-1H-pyrrole;Pyrrole, 2,5-dimethyl-1-phenyl- (8CI);1-cyclohexyl-2,5-dimethyl-1H-pyrrole;2,5-dimethyl-1-phenylpyrrolidine |
Moleküler Formülü | C12H17N |
Molekül Ağırlığı | 175.2701 |
InChI | InChI=1/C12H17N/c1-10-8-9-11(2)13(10)12-6-4-3-5-7-12/h3-7,10-11H,8-9H2,1-2H3 |
CAS kayıt numarası | 83-24-9 |
EINECS | 201-461-2 |
Moleküler Yapısı | ![]() |
Yoğunluk | 0.952g/cm3 |
Ergime noktası | 50-51℃ |
Kaynama noktası | 257.7°C at 760 mmHg |
Kırılma indisi | 1.519 |
Alevlenme noktası | 100.2°C |
Buhar basıncı | 0.0143mmHg at 25°C |
Güvenlik Açıklaması | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |