ChemIndex - Ücretsiz bir kimyasal CAS veritabanıChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Sodium 4-nitrophenoxide, hydrate |
|
Ürün Adı | Sodium 4-nitrophenoxide, hydrate |
ingilizce adı | Sodium 4-nitrophenoxide, hydrate;4-Nitrophenol sodium salt;sodium p-nitrophenolate;4-Nitropheol Sodium Salt;P-Nitro phenol sodium salt;Sodium 4-nitrophenoxide;sodium 4-nitrophenolate |
Moleküler Formülü | C6H4NNaO3 |
Molekül Ağırlığı | 161.0906 |
InChI | InChI=1/C6H5NO3.Na/c8-6-3-1-5(2-4-6)7(9)10;/h1-4,8H;/q;+1/p-1 |
CAS kayıt numarası | 824-78-2 |
EINECS | 212-536-4 |
Moleküler Yapısı | |
Ergime noktası | 300℃ |
Kaynama noktası | 279°C at 760 mmHg |
Alevlenme noktası | 141.9°C |
Buhar basıncı | 0.00243mmHg at 25°C |
Tehlike Sembolleri | Xn##Harmful:; |
Risk Kodları | R20/21/22||R33:; |
Güvenlik Açıklaması | S24/25##Avoid contact with skin and eyes.:; |
MSDS |