ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
81593-28-4 2,5-Diflorofenilglioksal hidrat |
|
Ürün Adı | 2,5-Diflorofenilglioksal hidrat |
Eş anlamlı | (2,5-diflorofenil) (okso) asetaldehit hidrat; |
ingilizce adı | 2,5-Difluorophenylglyoxal hydrate;(2,5-difluorophenyl)(oxo)acetaldehyde hydrate |
Moleküler Formülü | C8H6F2O3 |
Molekül Ağırlığı | 188.1282 |
InChI | InChI=1/C8H4F2O2.H2O/c9-5-1-2-7(10)6(3-5)8(12)4-11;/h1-4H;1H2 |
CAS kayıt numarası | 81593-28-4 |
Moleküler Yapısı | |
Kaynama noktası | 224.7°C at 760 mmHg |
Alevlenme noktası | 84.7°C |
Buhar basıncı | 0.0899mmHg at 25°C |
Risk Kodları | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |