ChemIndex - Ücretsiz bir kimyasal CAS veritabanıChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2,4-Dimetil-6- (1-metilsikloheksil) fenol |
|
Ürün Adı | 2,4-Dimetil-6- (1-metilsikloheksil) fenol |
Eş anlamlı | ; Lowinox(rg WSL; 6- (1-Metilsikloheksil) -2,4-ksilenol; |
ingilizce adı | 2,4-Dimethyl-6-(1-methylcyclohexyl)phenol;Lowinox(rg WSL;6-(1-Methylcyclohexyl)-2,4-xylenol |
Moleküler Formülü | C15H22O |
Molekül Ağırlığı | 218.3346 |
InChI | InChI=1/C15H22O/c1-11-9-12(2)14(16)13(10-11)15(3)7-5-4-6-8-15/h9-10,16H,4-8H2,1-3H3 |
CAS kayıt numarası | 77-61-2 |
EINECS | 201-042-4 |
Moleküler Yapısı | |
Yoğunluk | 0.992g/cm3 |
Kaynama noktası | 311°C at 760 mmHg |
Kırılma indisi | 1.532 |
Alevlenme noktası | 140°C |
Buhar basıncı | 0.000317mmHg at 25°C |
Risk Kodları | R36/37/38##Irritating to eyes, respiratory system and skin.||R43##May cause sensitization by skin contact.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |