ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
75-27-4 Bromodichloromethane |
|
Ürün Adı | Bromodichloromethane |
ingilizce adı | Bromodichloromethane;FC-20B1 |
Moleküler Formülü | CHBrCl2 |
Molekül Ağırlığı | 163.8286 |
InChI | InChI=1/CHBrCl2/c2-1(3)4/h1H |
CAS kayıt numarası | 75-27-4 |
EINECS | 200-856-7 |
Moleküler Yapısı | |
Yoğunluk | 2.013g/cm3 |
Ergime noktası | -55℃ |
Kaynama noktası | 89.7°C at 760 mmHg |
Kırılma indisi | 1.503 |
Alevlenme noktası | 1.3°C |
Buhar basıncı | 65.3mmHg at 25°C |
Tehlike Sembolleri | Xn##Harmful:; |
Risk Kodları | R22##Harmful if swallowed.||R40##Possible risks of irreversible effects.:; |
Güvenlik Açıklaması | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |