ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
716-53-0 9-chloroanthracene |
|
Ürün Adı | 9-chloroanthracene |
ingilizce adı | 9-chloroanthracene;Anthracene, 9-chloro-;9-Chloroanthracene;CCRIS 5547 |
Moleküler Formülü | C14H9Cl |
Molekül Ağırlığı | 212.6743 |
InChI | InChI=1/C14H9Cl/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9H |
CAS kayıt numarası | 716-53-0 |
EINECS | 211-937-1 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.253g/cm3 |
Ergime noktası | 103-103℃ |
Kaynama noktası | 370.1°C at 760 mmHg |
Kırılma indisi | 1.717 |
Alevlenme noktası | 179.2°C |
Buhar basıncı | 2.42E-05mmHg at 25°C |
Risk Kodları | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |