ChemIndex - Ücretsiz bir kimyasal CAS veritabanıChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Methyl 3-hydroxy-4-nitrobenzoate |
|
Ürün Adı | Methyl 3-hydroxy-4-nitrobenzoate |
ingilizce adı | Methyl 3-hydroxy-4-nitrobenzoate;3-Hydroxy-4-nitrobenzoic acid methyl ester;5-(methoxycarbonyl)-2-nitrophenolate |
Moleküler Formülü | C8H6NO5 |
Molekül Ağırlığı | 196.1375 |
InChI | InChI=1/C8H7NO5/c1-14-8(11)5-2-3-6(9(12)13)7(10)4-5/h2-4,10H,1H3/p-1 |
CAS kayıt numarası | 713-52-0 |
Moleküler Yapısı | |
Kaynama noktası | 346.4°C at 760 mmHg |
Alevlenme noktası | 163.3°C |
Buhar basıncı | 2.88E-05mmHg at 25°C |
Risk Kodları | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |