ChemIndex - Ücretsiz bir kimyasal CAS veritabanıChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Bis(2-thienyl) ketone |
|
Ürün Adı | Bis(2-thienyl) ketone |
ingilizce adı | Bis(2-thienyl) ketone;Di-2-thienyl ketone;Bis(2-thienyl)ketone~Di-2-thienyl ketone;dithiophen-2-ylmethanone |
Moleküler Formülü | C9H6OS2 |
Molekül Ağırlığı | 194.2733 |
InChI | InChI=1/C9H6OS2/c10-9(7-3-1-5-11-7)8-4-2-6-12-8/h1-6H |
CAS kayıt numarası | 704-38-1 |
Moleküler Yapısı | |
Yoğunluk | 1.326g/cm3 |
Ergime noktası | 89-91℃ |
Kaynama noktası | 323°C at 760 mmHg |
Kırılma indisi | 1.64 |
Alevlenme noktası | 149.1°C |
Buhar basıncı | 0.00027mmHg at 25°C |
Güvenlik Açıklaması | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |