ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
703-23-1 2-Hydroxy-6-methoxyacetophenone |
|
Ürün Adı | 2-Hydroxy-6-methoxyacetophenone |
ingilizce adı | 2-Hydroxy-6-methoxyacetophenone;1-(2-Hydroxy-6-methoxyphenyl)ethan-1-one;1-(2-hydroxy-6-methoxyphenyl)ethanone;2'-Hydroxy-6'-methoxyacetophenone |
Moleküler Formülü | C9H10O3 |
Molekül Ağırlığı | 166.1739 |
InChI | InChI=1/C9H10O3/c1-6(10)9-7(11)4-3-5-8(9)12-2/h3-5,11H,1-2H3 |
CAS kayıt numarası | 703-23-1 |
EINECS | 211-872-9 |
Moleküler Yapısı | |
Yoğunluk | 1.158g/cm3 |
Ergime noktası | 58-60℃ |
Kaynama noktası | 259.5°C at 760 mmHg |
Kırılma indisi | 1.537 |
Alevlenme noktası | 108.1°C |
Buhar basıncı | 0.00798mmHg at 25°C |
Risk Kodları | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |