ChemIndex - Ücretsiz bir kimyasal CAS veritabanıChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Alpha-Ethylphenethyl alcohol |
|
Ürün Adı | Alpha-Ethylphenethyl alcohol |
ingilizce adı | Alpha-Ethylphenethyl alcohol;1-Phenyl-2-butanol;1-phenylbutan-2-ol;(2S)-1-phenylbutan-2-ol;(2R)-1-phenylbutan-2-ol |
Moleküler Formülü | C10H14O |
Molekül Ağırlığı | 150.2176 |
InChI | InChI=1/C10H14O/c1-2-10(11)8-9-6-4-3-5-7-9/h3-7,10-11H,2,8H2,1H3/t10-/m1/s1 |
CAS kayıt numarası | 701-70-2 |
EINECS | 211-858-2 |
Moleküler Yapısı | |
Yoğunluk | 0.98g/cm3 |
Kaynama noktası | 226.6°C at 760 mmHg |
Kırılma indisi | 1.52 |
Alevlenme noktası | 100°C |
Buhar basıncı | 0.0459mmHg at 25°C |
Güvenlik Açıklaması | S24/25##Avoid contact with skin and eyes.:; |
MSDS |