ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
700-96-9 3,4-Dimethoxythiophenol |
|
Ürün Adı | 3,4-Dimethoxythiophenol |
ingilizce adı | 3,4-Dimethoxythiophenol;3,4-Dimethoxybenzenethiol |
Moleküler Formülü | C8H10O2S |
Molekül Ağırlığı | 170.22 |
InChI | InChI=1/C8H10O2S/c1-9-7-4-3-6(11)5-8(7)10-2/h3-5,11H,1-2H3 |
CAS kayıt numarası | 700-96-9 |
Moleküler Yapısı | |
Yoğunluk | 1.19 |
Kaynama noktası | 110℃(1 torr) |
Risk Kodları | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/38##Irritating to eyes and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |