ChemIndex - Ücretsiz bir kimyasal CAS veritabanıChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Benzoyl bromide |
|
Ürün Adı | Benzoyl bromide |
ingilizce adı | Benzoyl bromide; |
Moleküler Formülü | C7H5BrO |
Molekül Ağırlığı | 185.018 |
InChI | InChI=1/C7H5BrO/c8-7(9)6-4-2-1-3-5-6/h1-5H |
CAS kayıt numarası | 618-32-6 |
EINECS | 210-544-2 |
Moleküler Yapısı | |
Yoğunluk | 1.572g/cm3 |
Ergime noktası | -24℃ |
Kaynama noktası | 218.5°C at 760 mmHg |
Kırılma indisi | 1.584 |
Alevlenme noktası | 89.7°C |
Buhar basıncı | 0.125mmHg at 25°C |
Tehlike Sembolleri | C##Corrosive:; |
Risk Kodları | R34##Causes burns.:; |
Güvenlik Açıklaması | S25##Avoid contact with eyes.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |