ChemIndex - Ücretsiz bir kimyasal CAS veritabanıChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
o-Tolyl benzoate |
|
Ürün Adı | o-Tolyl benzoate |
ingilizce adı | o-Tolyl benzoate;o-Tolyl benzoate (Benzoic acid o-tolyl ester);Benzoic acid o-tolyl ester;2-methylphenyl benzoate |
Moleküler Formülü | C14H12O2 |
Molekül Ağırlığı | 212.2439 |
InChI | InChI=1/C14H12O2/c1-11-7-5-6-10-13(11)16-14(15)12-8-3-2-4-9-12/h2-10H,1H3 |
CAS kayıt numarası | 617-02-7 |
EINECS | 210-501-8 |
Moleküler Yapısı | |
Yoğunluk | 1.122g/cm3 |
Kaynama noktası | 368.9°C at 760 mmHg |
Kırılma indisi | 1.577 |
Alevlenme noktası | 154.5°C |
Buhar basıncı | 1.23E-05mmHg at 25°C |
Güvenlik Açıklaması | S24/25##Avoid contact with skin and eyes.:; |
MSDS |