ChemIndex - Ücretsiz bir kimyasal CAS veritabanıChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Chloro-5-methylphenol |
|
Ürün Adı | 2-Chloro-5-methylphenol |
ingilizce adı | 2-Chloro-5-methylphenol;4-Chloro-3-hydroxytoluene; 6-chloro-m-cresol |
Moleküler Formülü | C7H7ClO |
Molekül Ağırlığı | 142.58 |
InChI | InChI=1/C7H7ClO/c1-5-2-3-6(8)7(9)4-5/h2-4,9H,1H3 |
CAS kayıt numarası | 615-74-7 |
EINECS | 210-444-9 |
Moleküler Yapısı | |
Yoğunluk | 1.215 |
Ergime noktası | 45-48℃ |
Kaynama noktası | 196℃ |
Alevlenme noktası | 81℃ |
Tehlike Sembolleri | Xn##Harmful:; |
Risk Kodları | R21/22##Harmful in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |