ChemIndex - Ücretsiz bir kimyasal CAS veritabanıChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
P-tolil benzoat |
|
Ürün Adı | P-tolil benzoat |
Eş anlamlı | ;p-Tolil benzoat (Benzoik asit p-tolil ester); Benzoik asit p-tolil ester; 4-metilfenil benzoat; |
ingilizce adı | P-tolyl benzoate;p-Tolyl benzoate (Benzoic acid p-tolyl ester);Benzoic acid p-tolyl ester;4-methylphenyl benzoate |
Moleküler Formülü | C14H12O2 |
Molekül Ağırlığı | 212.2439 |
InChI | InChI=1/C14H12O2/c1-11-7-9-13(10-8-11)16-14(15)12-5-3-2-4-6-12/h2-10H,1H3 |
CAS kayıt numarası | 614-34-6 |
EINECS | 210-380-1 |
Moleküler Yapısı | |
Yoğunluk | 1.122g/cm3 |
Ergime noktası | 70-72℃ |
Kaynama noktası | 316.6°C at 760 mmHg |
Kırılma indisi | 1.577 |
Alevlenme noktası | 130.1°C |
Buhar basıncı | 0.000407mmHg at 25°C |
Güvenlik Açıklaması | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |