ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
611-79-0 3,3'-Diaminobenzophenone |
|
Ürün Adı | 3,3'-Diaminobenzophenone |
ingilizce adı | 3,3'-Diaminobenzophenone;bis(3-aminophenyl)methanone |
Moleküler Formülü | C13H12N2O |
Molekül Ağırlığı | 212.2472 |
InChI | InChI=1/C13H12N2O/c14-11-5-1-3-9(7-11)13(16)10-4-2-6-12(15)8-10/h1-8H,14-15H2 |
CAS kayıt numarası | 611-79-0 |
EINECS | 210-281-3 |
Moleküler Yapısı | |
Yoğunluk | 1.233g/cm3 |
Kaynama noktası | 469.4°C at 760 mmHg |
Kırılma indisi | 1.673 |
Alevlenme noktası | 237.7°C |
Buhar basıncı | 5.51E-09mmHg at 25°C |
Risk Kodları | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |