ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
610-96-8 Methyl 2-chlorobenzoate |
|
Ürün Adı | Methyl 2-chlorobenzoate |
ingilizce adı | Methyl 2-chlorobenzoate;Chlorobenzoic acid methyl ester;O-Chlorobenzoic Acid Methyl Ester;2-Chlorobenzoic Acid Methyl Ester |
Moleküler Formülü | C8H7ClO2 |
Molekül Ağırlığı | 170.593 |
InChI | InChI=1/C8H7ClO2/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5H,1H3 |
CAS kayıt numarası | 610-96-8 |
EINECS | 210-242-0 |
Moleküler Yapısı | |
Yoğunluk | 1.224g/cm3 |
Kaynama noktası | 225.4°C at 760 mmHg |
Kırılma indisi | 1.528 |
Alevlenme noktası | 101.7°C |
Buhar basıncı | 0.0868mmHg at 25°C |
Tehlike Sembolleri | Xi##Irritant:; |
Risk Kodları | R36/37/38:; |
Güvenlik Açıklaması | S24/25##Avoid contact with skin and eyes.:; |
MSDS |