ChemIndex - Ücretsiz bir kimyasal CAS veritabanıChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Methyl 2-nitrobenzoate |
|
Ürün Adı | Methyl 2-nitrobenzoate |
ingilizce adı | Methyl 2-nitrobenzoate;2-Nitrobenzoic acid methyl ester |
Moleküler Formülü | C8H7NO4 |
Molekül Ağırlığı | 181.1455 |
InChI | InChI=1/C8H7NO4/c1-13-8(10)6-4-2-3-5-7(6)9(11)12/h2-5H,1H3 |
CAS kayıt numarası | 606-27-9 |
EINECS | 210-111-8 |
Moleküler Yapısı | |
Yoğunluk | 1.301g/cm3 |
Ergime noktası | -13℃ |
Kaynama noktası | 275°C at 760 mmHg |
Kırılma indisi | 1.553 |
Alevlenme noktası | 124.8°C |
Buhar basıncı | 0.00523mmHg at 25°C |
Güvenlik Açıklaması | S24/25##Avoid contact with skin and eyes.:; |
MSDS |