ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
603-10-1 2,3,6-trinitrophenol moistened with water (H2O ~40%) |
|
Ürün Adı | 2,3,6-trinitrophenol moistened with water (H2O ~40%) |
ingilizce adı | 2,3,6-trinitrophenol moistened with water (H2O ~40%); |
Moleküler Formülü | C6H3N3O7 |
Molekül Ağırlığı | 229.1039 |
InChI | InChI=1/C6H3N3O7/c10-6-4(8(13)14)2-1-3(7(11)12)5(6)9(15)16/h1-2,10H |
CAS kayıt numarası | 603-10-1 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.856g/cm3 |
Ergime noktası | 119-120℃ |
Kaynama noktası | 337.9°C at 760 mmHg |
Kırılma indisi | 1.701 |
Alevlenme noktası | 151.1°C |
Buhar basıncı | 5.2E-05mmHg at 25°C |
MSDS |