ChemIndex - Ücretsiz bir kimyasal CAS veritabanıChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
5-Nitroacenaphthene |
|
Ürün Adı | 5-Nitroacenaphthene |
ingilizce adı | 5-Nitroacenaphthene;1,2-Dihydro-5-nitro-acenaphthylene;4-05-00-01840 (Beilstein Handbook Reference);5-Nan;5-Nitroacenaphthylene;5-Nitroacenapthene;5-Nitronaphthalene;5-Nitronaphthalene ethylene;Acenaphthene, 5-nitro-;Acenaphthylene, 1,2-dihydro-5-nitro-;BRN 1876864;CCRIS 438;HSDB 4092;NCI-C01967;NSC 1312;NSC 22421;1,2-Dihydro-5-nitroacenaphthylene;5-nitro-1,2-dihydroacenaphthylene;Nitroacenaphthene;1,2-dihydro-5-nitro-acenaphthylen |
Moleküler Formülü | C12H7NO2 |
Molekül Ağırlığı | 197.1895 |
InChI | InChI=1/C12H7NO2/c14-13(15)11-7-6-9-5-4-8-2-1-3-10(11)12(8)9/h1-7H |
CAS kayıt numarası | 602-87-9 |
EINECS | 210-025-0 |
Moleküler Yapısı | |
Yoğunluk | 1.408g/cm3 |
Ergime noktası | 101-102℃ |
Kaynama noktası | 381.6°C at 760 mmHg |
Kırılma indisi | 1.763 |
Alevlenme noktası | 196.7°C |
Buhar basıncı | 1.1E-05mmHg at 25°C |
Risk Kodları | R45##May cause cancer.:; |
Güvenlik Açıklaması | S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S53##Avoid exposure - obtain special instructions before use.:; |
MSDS |