ChemIndex - Ücretsiz bir kimyasal CAS veritabanıChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
3-Hydroxy-2-nitrobenzoic acid |
|
Ürün Adı | 3-Hydroxy-2-nitrobenzoic acid |
ingilizce adı | 3-Hydroxy-2-nitrobenzoic acid; |
Moleküler Formülü | C7H5NO5 |
Molekül Ağırlığı | 183.1183 |
InChI | InChI=1/C7H5NO5/c9-5-3-1-2-4(7(10)11)6(5)8(12)13/h1-3,9H,(H,10,11) |
CAS kayıt numarası | 602-00-6 |
Moleküler Yapısı | |
Yoğunluk | 1.631g/cm3 |
Kaynama noktası | 362.9°C at 760 mmHg |
Kırılma indisi | 1.663 |
Alevlenme noktası | 166.7°C |
Buhar basıncı | 6.68E-06mmHg at 25°C |
Risk Kodları | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |