ChemIndex - Ücretsiz bir kimyasal CAS veritabanıChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
5-Nitro-2-furonitrile |
|
Ürün Adı | 5-Nitro-2-furonitrile |
ingilizce adı | 5-Nitro-2-furonitrile;5-Nitro-2-furancarbonitrile;5-nitrofuran-2-carbonitrile |
Moleküler Formülü | C5H2N2O3 |
Molekül Ağırlığı | 138.081 |
InChI | InChI=1/C5H2N2O3/c6-3-4-1-2-5(10-4)7(8)9/h1-2H |
CAS kayıt numarası | 59-82-5 |
Moleküler Yapısı | |
Yoğunluk | 1.46g/cm3 |
Kaynama noktası | 234.7°C at 760 mmHg |
Kırılma indisi | 1.544 |
Alevlenme noktası | 95.7°C |
Buhar basıncı | 0.0522mmHg at 25°C |
Risk Kodları | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Güvenlik Açıklaması | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |