ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
58403-03-5 2- (2-klorofenoksi) etanimidamid hidroklorür |
|
Ürün Adı | 2- (2-klorofenoksi) etanimidamid hidroklorür |
Eş anlamlı | Etanimidamid, 2- (2-klorofenoksi) -, monohidroklorür; 2- (2-Klorofenoksi) asetamid hidroklorür; 2- (2-Klorofenoksi) ethanimidamid monohidroklorür; (1Z) -2- (2-klorofenoksi) etanimidamid hidroklorür; |
ingilizce adı | 2-(2-chlorophenoxy)ethanimidamide hydrochloride;Ethanimidamide, 2-(2-chlorophenoxy)-, monohydrochloride;2-(2-Chlorophenoxy)acetamide hydrochloride;2-(2-Chlorophenoxy)ethanimidamide monohydrochloride;(1Z)-2-(2-chlorophenoxy)ethanimidamide hydrochloride |
Moleküler Formülü | C8H10Cl2N2O |
Molekül Ağırlığı | 221.0838 |
InChI | InChI=1/C8H9ClN2O.ClH/c9-6-3-1-2-4-7(6)12-5-8(10)11;/h1-4H,5H2,(H3,10,11);1H |
CAS kayıt numarası | 58403-03-5 |
Moleküler Yapısı | |
Ergime noktası | 165℃ |
Kaynama noktası | 303.6°C at 760 mmHg |
Alevlenme noktası | 137.4°C |
Buhar basıncı | 0.000922mmHg at 25°C |
Tehlike Sembolleri | Xn##Harmful:; |
Risk Kodları | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |