Chemindex > 578-46-1
TR ▼
578-46-1 5-Methyl-2-nitroaniline |
|
| Ürün Adı | 5-Methyl-2-nitroaniline |
| ingilizce adı | 5-Methyl-2-nitroaniline;3-Amino-4-nitrotoluene;6-Nitro-m-toluidine;5-Methyl-2-nitrophenylamine;5-Methyl-2-nitro phenylamine |
| Moleküler Formülü | C7H8N2O2 |
| Molekül Ağırlığı | 152.1506 |
| InChI | InChI=1/C7H8N2O2/c1-5-2-3-7(9(10)11)6(8)4-5/h2-4H,8H2,1H3 |
| CAS kayıt numarası | 578-46-1 |
| EINECS | 209-423-7 |
| Moleküler Yapısı |  |
| Yoğunluk | 1.269g/cm3 |
| Kaynama noktası | 312.4°C at 760 mmHg |
| Kırılma indisi | 1.615 |
| Alevlenme noktası | 142.8°C |
| Buhar basıncı | 0.000529mmHg at 25°C |
| Risk Kodları | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.||R33##Danger of cummulative effects.||R51/53##Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.:; |
| Güvenlik Açıklaması | S28##After contact with skin, wash immediately with plenty of ...||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S61##Avoid release to the environment. Refer to special instructions / Safety data sheets.:; |
| MSDS | |
- Çin'den kimyasal tedarik etmeyi planlıyorsanız, sadece ChemNet alışveriş merkezine gidin, sizin için Çinli üreticilerden en son ve rekabetçi fiyatı alacağız.Lütfen ziyaret edin
ChemNet Mall
Chemical CAS Veritabanı Hizmeti, ChemIndex.com tarafından sağlanmaktadır. 