ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54376-65-7 4-Diethylaminobenzaldehyde oxime |
|
Ürün Adı | 4-Diethylaminobenzaldehyde oxime |
ingilizce adı | 4-Diethylaminobenzaldehyde oxime;4-Diethylaminobenzaldoxime |
Moleküler Formülü | C11H16N2O |
Molekül Ağırlığı | 192.2575 |
InChI | InChI=1/C11H16N2O/c1-3-13(4-2)11-7-5-10(6-8-11)9-12-14/h5-9,14H,3-4H2,1-2H3/b12-9+ |
CAS kayıt numarası | 54376-65-7 |
Moleküler Yapısı | |
Yoğunluk | 1g/cm3 |
Kaynama noktası | 307.7°C at 760 mmHg |
Kırılma indisi | 1.517 |
Alevlenme noktası | 139.9°C |
Buhar basıncı | 0.000309mmHg at 25°C |
Risk Kodları | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |