ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54263-82-0 3-Dimetilaminobenzoil klorür |
|
Ürün Adı | 3-Dimetilaminobenzoil klorür |
Eş anlamlı | |
ingilizce adı | 3-Dimethylaminobenzoyl chloride; |
Moleküler Formülü | C9H10ClNO |
Molekül Ağırlığı | 183.6348 |
InChI | InChI=1/C9H10ClNO/c1-11(2)8-5-3-4-7(6-8)9(10)12/h3-6H,1-2H3 |
CAS kayıt numarası | 54263-82-0 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.193g/cm3 |
Kaynama noktası | 275.9°C at 760 mmHg |
Kırılma indisi | 1.574 |
Alevlenme noktası | 120.7°C |
Buhar basıncı | 0.00495mmHg at 25°C |
Risk Kodları | R34##Causes burns.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |