ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
513-92-8 tetraiodoethylene |
|
Ürün Adı | tetraiodoethylene |
ingilizce adı | tetraiodoethylene;diiodoform;tetraiodoethene |
Moleküler Formülü | C2I4 |
Molekül Ağırlığı | 531.6393 |
InChI | InChI=1/C2I4/c3-1(4)2(5)6 |
CAS kayıt numarası | 513-92-8 |
EINECS | 208-176-2 |
Moleküler Yapısı | ![]() |
Yoğunluk | 4.087g/cm3 |
Ergime noktası | 191-193℃ |
Kaynama noktası | 288.3°C at 760 mmHg |
Kırılma indisi | 1.952 |
Alevlenme noktası | 139.9°C |
Buhar basıncı | 0.00409mmHg at 25°C |
Risk Kodları | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |