ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
501-24-6 3-n-Pentadecylphenol |
|
Ürün Adı | 3-n-Pentadecylphenol |
ingilizce adı | 3-n-Pentadecylphenol;Pentadecylphenol;3-pentadecylphenol;3-Pentadecyl phenol |
Moleküler Formülü | C21H36O |
Molekül Ağırlığı | 304.5099 |
InChI | InChI=1/C21H36O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-20-17-15-18-21(22)19-20/h15,17-19,22H,2-14,16H2,1H3 |
CAS kayıt numarası | 501-24-6 |
EINECS | 207-921-9 |
Moleküler Yapısı | ![]() |
Yoğunluk | 0.908g/cm3 |
Ergime noktası | 47-53℃ |
Kaynama noktası | 402°C at 760 mmHg |
Kırılma indisi | 1.495 |
Alevlenme noktası | 246.3°C |
Buhar basıncı | 4.88E-07mmHg at 25°C |
Tehlike Sembolleri | |
Risk Kodları | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |