ChemIndex - Ücretsiz bir kimyasal CAS veritabanıChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
cis-Decahydronaphthalene |
|
Ürün Adı | cis-Decahydronaphthalene |
ingilizce adı | cis-Decahydronaphthalene;cis-bicyclo(4.4.0)decane;cis-decaline;Decahydronaphthalene;Deca hydro naphthalene;Decalin |
Moleküler Formülü | C10H18 |
Molekül Ağırlığı | 138.2499 |
InChI | InChI=1/C10H18/c1-2-6-10-8-4-3-7-9(10)5-1/h9-10H,1-8H2/t9-,10+ |
CAS kayıt numarası | 493-01-6;91-17-8 |
EINECS | 202-046-9 |
Moleküler Yapısı | |
Yoğunluk | 0.873g/cm3 |
Ergime noktası | -31℃ |
Kaynama noktası | 190.879°C at 760 mmHg |
Kırılma indisi | 1.47 |
Alevlenme noktası | 57.222°C |
Suda çözünürlük | 6 mg/L at 20℃ |
Buhar basıncı | 0.735mmHg at 25°C |
Tehlike Sembolleri | Xi##Irritant:; |
Risk Kodları | R20##Harmful by inhalation.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |