ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
465514-33-4 (2-morfolinofenil)metanol |
|
Ürün Adı | (2-morfolinofenil)metanol |
Eş anlamlı | (2-morfolin-4-ilfenil)metanol; |
ingilizce adı | (2-morpholinophenyl)methanol;(2-morpholin-4-ylphenyl)methanol |
Moleküler Formülü | C11H15NO2 |
Molekül Ağırlığı | 193.2423 |
InChI | InChI=1/C11H15NO2/c13-9-10-3-1-2-4-11(10)12-5-7-14-8-6-12/h1-4,13H,5-9H2 |
CAS kayıt numarası | 465514-33-4 |
Moleküler Yapısı | |
Yoğunluk | 1.16g/cm3 |
Ergime noktası | 54℃ |
Kaynama noktası | 362.8°C at 760 mmHg |
Kırılma indisi | 1.568 |
Alevlenme noktası | 173.2°C |
Buhar basıncı | 6.7E-06mmHg at 25°C |
Tehlike Sembolleri | Xi##Irritant:; |
Risk Kodları | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |