ChemIndex - Ücretsiz bir kimyasal CAS veritabanıChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1-(4-fluorophenyl)-2-thiourea |
|
Ürün Adı | 1-(4-fluorophenyl)-2-thiourea |
ingilizce adı | 1-(4-fluorophenyl)-2-thiourea;4-Fluorophenylthiourea;1-(4-fluorophenyl)thiourea |
Moleküler Formülü | C7H7FN2S |
Molekül Ağırlığı | 170.2073 |
InChI | InChI=1/C7H7FN2S/c8-5-1-3-6(4-2-5)10-7(9)11/h1-4H,(H3,9,10,11) |
CAS kayıt numarası | 459-05-2 |
Moleküler Yapısı | |
Yoğunluk | 1.397g/cm3 |
Ergime noktası | 164℃ |
Kaynama noktası | 264.2°C at 760 mmHg |
Kırılma indisi | 1.692 |
Alevlenme noktası | 113.6°C |
Buhar basıncı | 0.00987mmHg at 25°C |
Risk Kodları | R25##Toxic if swallowed.:; |
Güvenlik Açıklaması | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |