ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
458-05-9 1-(3-fluorophenyl)-2-thiourea |
|
Ürün Adı | 1-(3-fluorophenyl)-2-thiourea |
ingilizce adı | 1-(3-fluorophenyl)-2-thiourea;3-Fluorophenylthiourea;1-(3-fluorophenyl)thiourea |
Moleküler Formülü | C7H7FN2S |
Molekül Ağırlığı | 170.2073 |
InChI | InChI=1/C7H7FN2S/c8-5-2-1-3-6(4-5)10-7(9)11/h1-4H,(H3,9,10,11) |
CAS kayıt numarası | 458-05-9 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.397g/cm3 |
Kaynama noktası | 259.3°C at 760 mmHg |
Kırılma indisi | 1.692 |
Alevlenme noktası | 110.6°C |
Buhar basıncı | 0.0131mmHg at 25°C |
Risk Kodları | R25##Toxic if swallowed.:; |
Güvenlik Açıklaması | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |