ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
455-84-5 4-Fluoro-3-methylbenzoyl chloride |
|
Ürün Adı | 4-Fluoro-3-methylbenzoyl chloride |
ingilizce adı | 4-Fluoro-3-methylbenzoyl chloride;4-Fluoro-m-toluoyl chloride |
Moleküler Formülü | C8H6ClFO |
Molekül Ağırlığı | 172.584 |
InChI | InChI=1/C8H6ClFO/c1-5-4-6(8(9)11)2-3-7(5)10/h2-4H,1H3 |
CAS kayıt numarası | 455-84-5 |
Moleküler Yapısı | |
Yoğunluk | 1.265g/cm3 |
Kaynama noktası | 214.1°C at 760 mmHg |
Kırılma indisi | 1.518 |
Alevlenme noktası | 83.3°C |
Buhar basıncı | 0.158mmHg at 25°C |
Risk Kodları | R34##Causes burns.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |