ChemIndex - Ücretsiz bir kimyasal CAS veritabanıChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1-Chloro-3-fluoro-2-propanol |
|
Ürün Adı | 1-Chloro-3-fluoro-2-propanol |
ingilizce adı | 1-Chloro-3-fluoro-2-propanol;1-Chloro-3-fluoroisopropanol;1-chloro-3-fluoropropan-2-ol |
Moleküler Formülü | C3H6ClFO |
Molekül Ağırlığı | 112.5305 |
InChI | InChI=1/C3H6ClFO/c4-1-3(6)2-5/h3,6H,1-2H2 |
CAS kayıt numarası | 453-11-2 |
Moleküler Yapısı | |
Yoğunluk | 1.212g/cm3 |
Kaynama noktası | 158.1°C at 760 mmHg |
Kırılma indisi | 1.399 |
Alevlenme noktası | 49.4°C |
Buhar basıncı | 0.951mmHg at 25°C |
Risk Kodları | R10##Flammable.||R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Güvenlik Açıklaması | S23##Do not inhale gas/fumes/vapour/spray.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |