ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4521-31-7 2-Mercaptobenzyl alcohol |
|
Ürün Adı | 2-Mercaptobenzyl alcohol |
ingilizce adı | 2-Mercaptobenzyl alcohol;2-(Hydroxymethyl)thiophenol;O-Mercaptobenzyl alcohol;(2-Sulfanylphenyl)methanol;2- Mercaptobenzyl alcohol, tech. ;2-(hydroxymethyl)benzenethiolate |
Moleküler Formülü | C7H7OS |
Molekül Ağırlığı | 139.1954 |
InChI | InChI=1/C7H8OS/c8-5-6-3-1-2-4-7(6)9/h1-4,8-9H,5H2/p-1 |
CAS kayıt numarası | 4521-31-7 |
Moleküler Yapısı | |
Ergime noktası | 31-32℃ |
Kaynama noktası | 276.5°C at 760 mmHg |
Alevlenme noktası | 121°C |
Buhar basıncı | 0.00231mmHg at 25°C |
Risk Kodları | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/38##Irritating to eyes and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |