ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
446-22-0 2'-fluoropropiophenone |
|
Ürün Adı | 2'-fluoropropiophenone |
ingilizce adı | 2'-fluoropropiophenone;2'-fluoro-1-phenylpropan-1-one;1-(2'-fluorophenyl)propan-1-one;2-Fluoropropiophenone |
Moleküler Formülü | C9H9FO |
Molekül Ağırlığı | 152.1656 |
InChI | InChI=1/C9H9FO/c1-2-9(11)7-5-3-4-6-8(7)10/h3-6H,2H2,1H3 |
CAS kayıt numarası | 446-22-0 |
EINECS | 244-220-7 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.074g/cm3 |
Kaynama noktası | 204.119°C at 760 mmHg |
Kırılma indisi | 1.489 |
Alevlenme noktası | 77.067°C |
Buhar basıncı | 0.268mmHg at 25°C |
Risk Kodları | R36/38##Irritating to eyes and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |