ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
402-63-1 1-(3-fluorophenyl)ethanol |
|
Ürün Adı | 1-(3-fluorophenyl)ethanol |
ingilizce adı | 1-(3-fluorophenyl)ethanol;3-fluorophenyl methyl carbinol;3-Fluoro-alpha-methylbenzyl alcohol~3-Fluorophenyl methyl carbinol;3-Fluoro-α-methylbenzenemethanol |
Moleküler Formülü | C8H9FO |
Molekül Ağırlığı | 140.1549 |
InChI | InChI=1/C8H9FO/c1-6(10)7-3-2-4-8(9)5-7/h2-6,10H,1H3 |
CAS kayıt numarası | 402-63-1 |
EINECS | 206-950-4 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.123g/cm3 |
Kaynama noktası | 196.2°C at 760 mmHg |
Kırılma indisi | 1.51 |
Alevlenme noktası | 90.1°C |
Buhar basıncı | 0.251mmHg at 25°C |
Güvenlik Açıklaması | S24/25##Avoid contact with skin and eyes.:; |
MSDS |