ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
39978-14-8 Methyl 3-aminothiophene-4-carboxylate hydrochloride |
|
Ürün Adı | Methyl 3-aminothiophene-4-carboxylate hydrochloride |
ingilizce adı | Methyl 3-aminothiophene-4-carboxylate hydrochloride;methyl 4-aminothiophene-3-carboxylate hydrochloride;methyl 4-aminothiophene-3-carboxylate |
Moleküler Formülü | C6H7NO2S |
Molekül Ağırlığı | 157.1903 |
InChI | InChI=1/C6H7NO2S/c1-9-6(8)4-2-10-3-5(4)7/h2-3H,7H2,1H3 |
CAS kayıt numarası | 39978-14-8 |
Moleküler Yapısı | |
Yoğunluk | 1.319g/cm3 |
Ergime noktası | 203℃ |
Kaynama noktası | 295.9°C at 760 mmHg |
Kırılma indisi | 1.598 |
Alevlenme noktası | 132.8°C |
Buhar basıncı | 0.00148mmHg at 25°C |
Güvenlik Açıklaması | S24/25##Avoid contact with skin and eyes.:; |
MSDS |