ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
349-01-9 2,4-dinitro-5-fluorotoluene |
|
Ürün Adı | 2,4-dinitro-5-fluorotoluene |
ingilizce adı | 2,4-dinitro-5-fluorotoluene;1-Fluoro-5-methyl-2,4-dinitrobenzene |
Moleküler Formülü | C7H5FN2O4 |
Molekül Ağırlığı | 200.124 |
InChI | InChI=1/C7H5FN2O4/c1-4-2-5(8)7(10(13)14)3-6(4)9(11)12/h2-3H,1H3 |
CAS kayıt numarası | 349-01-9 |
Moleküler Yapısı | |
Yoğunluk | 1.497g/cm3 |
Ergime noktası | 82℃ |
Kaynama noktası | 319°C at 760 mmHg |
Kırılma indisi | 1.575 |
Alevlenme noktası | 146.8°C |
Buhar basıncı | 0.000649mmHg at 25°C |
Tehlike Sembolleri | T##Toxic:; |
Risk Kodları | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.:; |
Güvenlik Açıklaması | S28A##After contact with skin, wash immediately with plenty of water.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S38##In case of insufficient ventilation, wear suitable respiratory equipment.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |