ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
347-55-7 2-(trifluoromethylthio)aniline |
|
Ürün Adı | 2-(trifluoromethylthio)aniline |
ingilizce adı | 2-(trifluoromethylthio)aniline;2-Aminophenyl trifluoromethyl sulphide;4-(3-fluoro-4-methoxyphenyl)-4-oxobutanoic acid |
Moleküler Formülü | C11H11FO4 |
Molekül Ağırlığı | 226.201 |
InChI | InChI=1/C11H11FO4/c1-16-10-4-2-7(6-8(10)12)9(13)3-5-11(14)15/h2,4,6H,3,5H2,1H3,(H,14,15) |
CAS kayıt numarası | 347-55-7 |
EINECS | 206-473-1 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.279g/cm3 |
Kaynama noktası | 422.6°C at 760 mmHg |
Kırılma indisi | 1.52 |
Alevlenme noktası | 209.4°C |
Buhar basıncı | 6.78E-08mmHg at 25°C |
Risk Kodları | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Güvenlik Açıklaması | S28##After contact with skin, wash immediately with plenty of ...||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |