ChemIndex - Ücretsiz bir kimyasal CAS veritabanıChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
dimethyl fluoromalonate |
|
Ürün Adı | dimethyl fluoromalonate |
ingilizce adı | dimethyl fluoromalonate;Fluoromalonic acid dimethyl ester;dimethyl fluoropropanedioate;2-Fluoro-malonic acid dimethyl ester |
Moleküler Formülü | C5H7FO4 |
Molekül Ağırlığı | 150.1051 |
InChI | InChI=1/C5H7FO4/c1-9-4(7)3(6)5(8)10-2/h3H,1-2H3 |
CAS kayıt numarası | 344-14-9 |
Moleküler Yapısı | |
Yoğunluk | 1.211g/cm3 |
Kaynama noktası | 140.3°C at 760 mmHg |
Kırılma indisi | 1.382 |
Alevlenme noktası | 38.4°C |
Buhar basıncı | 6.18mmHg at 25°C |
Risk Kodları | R34##Causes burns.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |