ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
33904-03-9 2,4-dimethoxyphenyl isothiocyanate |
|
Ürün Adı | 2,4-dimethoxyphenyl isothiocyanate |
ingilizce adı | 2,4-dimethoxyphenyl isothiocyanate; |
Moleküler Formülü | C9H9NO2S |
Molekül Ağırlığı | 195.2383 |
InChI | InChI=1/C9H9NO2S/c1-11-7-3-4-8(10-6-13)9(5-7)12-2/h3-5H,1-2H3 |
CAS kayıt numarası | 33904-03-9 |
Moleküler Yapısı | |
Yoğunluk | 1.12g/cm3 |
Ergime noktası | 51℃ |
Kaynama noktası | 331°C at 760 mmHg |
Kırılma indisi | 1.537 |
Alevlenme noktası | 154°C |
Buhar basıncı | 0.000308mmHg at 25°C |
Tehlike Sembolleri | Xn##Harmful:; |
Risk Kodları | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |