ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
339-59-3 4-(Trifluoromethyl)benzhydrazide |
|
Ürün Adı | 4-(Trifluoromethyl)benzhydrazide |
ingilizce adı | 4-(Trifluoromethyl)benzhydrazide;4-(Trifluoromethyl)benzohydrazide;TIMTEC-BB SBB001890;4-(TRIFLUOROMETHYL)BENZOIC ACID HYDRAZIDE;4-(TRIFLUOROMETHYL)BENZENE-1-CARBOHYDRAZIDE;ALPHA,ALPHA,ALPHA-TRIFLUORO-P-TOLUIC ACID HYDRAZIDE;AKOS BBS-00001991;BUTTPARK 30\01-48;ethyl N-(3-chloro-4-fluorophenyl)-N-(phenylcarbonyl)alaninate;4-(Trifluoromethyl)-benzoic acid hydrazide |
Moleküler Formülü | C18H17ClFNO3 |
Molekül Ağırlığı | 349.7839 |
InChI | InChI=1/C18H17ClFNO3/c1-3-24-18(23)12(2)21(14-9-10-16(20)15(19)11-14)17(22)13-7-5-4-6-8-13/h4-12H,3H2,1-2H3 |
CAS kayıt numarası | 339-59-3 |
Moleküler Yapısı | |
Yoğunluk | 1.281g/cm3 |
Ergime noktası | 115-119℃ |
Kaynama noktası | 470.6°C at 760 mmHg |
Kırılma indisi | 1.578 |
Alevlenme noktası | 238.4°C |
Buhar basıncı | 5.01E-09mmHg at 25°C |
Tehlike Sembolleri | Xi##Irritant:; |
Risk Kodları | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |