ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
332-51-4 (4-fluorophenylthio)acetic acid |
|
Ürün Adı | (4-fluorophenylthio)acetic acid |
ingilizce adı | (4-fluorophenylthio)acetic acid;2-[(4-Fluorophenyl)thio]acetic acid;[(4-fluorophenyl)sulfanyl]acetic acid;[(4-fluorophenyl)sulfanyl]acetate;2-(4-Fluorophenylthio)acetic acid |
Moleküler Formülü | C8H6FO2S |
Molekül Ağırlığı | 185.196 |
InChI | InChI=1/C8H7FO2S/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5H2,(H,10,11)/p-1 |
CAS kayıt numarası | 332-51-4 |
Moleküler Yapısı | ![]() |
Ergime noktası | 76-79℃ |
Kaynama noktası | 315.4°C at 760 mmHg |
Alevlenme noktası | 144.5°C |
Buhar basıncı | 0.000185mmHg at 25°C |
Tehlike Sembolleri | |
Risk Kodları | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |