ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
332-43-4 1-(2-chloroethyl)-4-fluorobenzene |
|
Ürün Adı | 1-(2-chloroethyl)-4-fluorobenzene |
ingilizce adı | 1-(2-chloroethyl)-4-fluorobenzene;4-Fluorophenethyl chloride~2-(4-Fluorophenyl)ethyl chloride |
Moleküler Formülü | C8H8ClF |
Molekül Ağırlığı | 158.6005 |
InChI | InChI=1/C8H8ClF/c9-6-5-7-1-3-8(10)4-2-7/h1-4H,5-6H2 |
CAS kayıt numarası | 332-43-4 |
EINECS | 206-364-9 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.15g/cm3 |
Kaynama noktası | 204.6°C at 760 mmHg |
Kırılma indisi | 1.501 |
Alevlenme noktası | 79.9°C |
Buhar basıncı | 0.373mmHg at 25°C |
Risk Kodları | R36/38##Irritating to eyes and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |