ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
331-62-4 3-fluoro-4-methoxybenzonitrile |
|
Ürün Adı | 3-fluoro-4-methoxybenzonitrile |
ingilizce adı | 3-fluoro-4-methoxybenzonitrile;Fluoromethoxybenzonitrile |
Moleküler Formülü | C8H6FNO |
Molekül Ağırlığı | 151.1377 |
InChI | InChI=1/C8H6FNO/c1-11-8-3-2-6(5-10)4-7(8)9/h2-4H,1H3 |
CAS kayıt numarası | 331-62-4 |
Moleküler Yapısı | |
Yoğunluk | 1.18g/cm3 |
Kaynama noktası | 254.3°C at 760 mmHg |
Kırılma indisi | 1.505 |
Alevlenme noktası | 107.6°C |
Buhar basıncı | 0.0173mmHg at 25°C |
Risk Kodları | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Güvenlik Açıklaması | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |